C10H8F2N6O2 — CID 670449
2,4-difluoro-N'-[2-(tetrazol-1-yl)acetyl]benzohydrazide (PubChem CID 670449) has the molecular formula C10H8F2N6O2 and a molecular weight of 282.21 g/mol. Its IUPAC name is 2,4-difluoro-N'-[2-(tetrazol-1-yl)acetyl]benzohydrazide.
| Compound Name | 2,4-difluoro-N'-[2-(tetrazol-1-yl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 670449 |
| Molecular Formula | C10H8F2N6O2 |
| Molecular Weight | 282.21 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 2,4-difluoro-N'-[2-(tetrazol-1-yl)acetyl]benzohydrazide |
| SMILES | O=C(Cn1cnnn1)NNC(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C10H8F2N6O2/c11-6-1-2-7(8(12)3-6)10(20)15-14-9(19)4-18-5-13-16-17-18/h1-3,5H,4H2,(H,14,19)(H,15,20) |
| InChIKey | YLLKPODIDPLTHW-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.21 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|