C19H17BrFNO3 — CID 55897249
N-[2-(3-bromo-4-fluorophenyl)ethyl]-5-methoxy-3-methyl-1-benzofuran-2-carboxamide (PubChem CID 55897249) has the molecular formula C19H17BrFNO3 and a molecular weight of 406.25 g/mol. Its IUPAC name is N-[2-(3-bromo-4-fluorophenyl)ethyl]-5-methoxy-3-methyl-1-benzofuran-2-carboxamide.
| Compound Name | N-[2-(3-bromo-4-fluorophenyl)ethyl]-5-methoxy-3-methyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 55897249 |
| Molecular Formula | C19H17BrFNO3 |
| Molecular Weight | 406.25 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | N-[2-(3-bromo-4-fluorophenyl)ethyl]-5-methoxy-3-methyl-1-benzofuran-2-carboxamide |
| SMILES | COc1ccc2oc(C(=O)NCCc3ccc(F)c(Br)c3)c(C)c2c1 |
| InChI | InChI=1S/C19H17BrFNO3/c1-11-14-10-13(24-2)4-6-17(14)25-18(11)19(23)22-8-7-12-3-5-16(21)15(20)9-12/h3-6,9-10H,7-8H2,1-2H3,(H,22,23) |
| InChIKey | FDOHKBGDSKGXCE-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.25 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |