C18H19BrFNO4 — CID 60536373
N-[2-(3-bromo-4-fluorophenyl)ethyl]-2,3,4-trimethoxybenzamide (PubChem CID 60536373) has the molecular formula C18H19BrFNO4 and a molecular weight of 412.26 g/mol. Its IUPAC name is N-[2-(3-bromo-4-fluorophenyl)ethyl]-2,3,4-trimethoxybenzamide.
| Compound Name | N-[2-(3-bromo-4-fluorophenyl)ethyl]-2,3,4-trimethoxybenzamide |
|---|---|
| PubChem CID | 60536373 |
| Molecular Formula | C18H19BrFNO4 |
| Molecular Weight | 412.26 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | N-[2-(3-bromo-4-fluorophenyl)ethyl]-2,3,4-trimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NCCc2ccc(F)c(Br)c2)c(OC)c1OC |
| InChI | InChI=1S/C18H19BrFNO4/c1-23-15-7-5-12(16(24-2)17(15)25-3)18(22)21-9-8-11-4-6-14(20)13(19)10-11/h4-7,10H,8-9H2,1-3H3,(H,21,22) |
| InChIKey | BRFCYPOHTIMLCA-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.26 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |