C16H15F2NO2 — CID 31116362
5-fluoro-N-[2-(3-fluorophenyl)ethyl]-2-methoxybenzamide (PubChem CID 31116362) has the molecular formula C16H15F2NO2 and a molecular weight of 291.30 g/mol. Its IUPAC name is 5-fluoro-N-[2-(3-fluorophenyl)ethyl]-2-methoxybenzamide.
| Compound Name | 5-fluoro-N-[2-(3-fluorophenyl)ethyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 31116362 |
| Molecular Formula | C16H15F2NO2 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 5-fluoro-N-[2-(3-fluorophenyl)ethyl]-2-methoxybenzamide |
| SMILES | COc1ccc(F)cc1C(=O)NCCc1cccc(F)c1 |
| InChI | InChI=1S/C16H15F2NO2/c1-21-15-6-5-13(18)10-14(15)16(20)19-8-7-11-3-2-4-12(17)9-11/h2-6,9-10H,7-8H2,1H3,(H,19,20) |
| InChIKey | OKSZBAZDGNAHLR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |