C23H28N2O3 — CID 8948017
N-[[4-(diethylaminomethyl)phenyl]methyl]-5-methoxy-3-methyl-1-benzofuran-2-carboxamide (PubChem CID 8948017) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is N-[[4-(diethylaminomethyl)phenyl]methyl]-5-methoxy-3-methyl-1-benzofuran-2-carboxamide.
| Compound Name | N-[[4-(diethylaminomethyl)phenyl]methyl]-5-methoxy-3-methyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 8948017 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | N-[[4-(diethylaminomethyl)phenyl]methyl]-5-methoxy-3-methyl-1-benzofuran-2-carboxamide |
| SMILES | CCN(CC)Cc1ccc(CNC(=O)c2oc3ccc(OC)cc3c2C)cc1 |
| InChI | InChI=1S/C23H28N2O3/c1-5-25(6-2)15-18-9-7-17(8-10-18)14-24-23(26)22-16(3)20-13-19(27-4)11-12-21(20)28-22/h7-13H,5-6,14-15H2,1-4H3,(H,24,26) |
| InChIKey | CBNNQNALKWOGCQ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |