C16H14N4O3S — CID 134025231
N'-(4-ethylbenzoyl)-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carbohydrazide (PubChem CID 134025231) has the molecular formula C16H14N4O3S and a molecular weight of 342.38 g/mol. Its IUPAC name is N'-(4-ethylbenzoyl)-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carbohydrazide.
| Compound Name | N'-(4-ethylbenzoyl)-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carbohydrazide |
|---|---|
| PubChem CID | 134025231 |
| Molecular Formula | C16H14N4O3S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | N'-(4-ethylbenzoyl)-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carbohydrazide |
| SMILES | CCc1ccc(C(=O)NNC(=O)c2cnc3sccn3c2=O)cc1 |
| InChI | InChI=1S/C16H14N4O3S/c1-2-10-3-5-11(6-4-10)13(21)18-19-14(22)12-9-17-16-20(15(12)23)7-8-24-16/h3-9H,2H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | DNALAMBYXNPNJX-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 92.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|