C18H19N3O4 — CID 9297211
3-methyl-N'-(3-methyl-1-benzofuran-2-carbonyl)-5-propan-2-yl-1,2-oxazole-4-carbohydrazide (PubChem CID 9297211) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is 3-methyl-N'-(3-methyl-1-benzofuran-2-carbonyl)-5-propan-2-yl-1,2-oxazole-4-carbohydrazide.
| Compound Name | 3-methyl-N'-(3-methyl-1-benzofuran-2-carbonyl)-5-propan-2-yl-1,2-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 9297211 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 3-methyl-N'-(3-methyl-1-benzofuran-2-carbonyl)-5-propan-2-yl-1,2-oxazole-4-carbohydrazide |
| SMILES | Cc1noc(C(C)C)c1C(=O)NNC(=O)c1oc2ccccc2c1C |
| InChI | InChI=1S/C18H19N3O4/c1-9(2)15-14(11(4)21-25-15)17(22)19-20-18(23)16-10(3)12-7-5-6-8-13(12)24-16/h5-9H,1-4H3,(H,19,22)(H,20,23) |
| InChIKey | WBBNNDUKAJENEU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 97.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|