C21H15ClFN3O4 — CID 26377118
3-(2-chloro-6-fluorophenyl)-5-methyl-N'-(3-methyl-1-benzofuran-2-carbonyl)-1,2-oxazole-4-carbohydrazide (PubChem CID 26377118) has the molecular formula C21H15ClFN3O4 and a molecular weight of 427.82 g/mol. Its IUPAC name is 3-(2-chloro-6-fluorophenyl)-5-methyl-N'-(3-methyl-1-benzofuran-2-carbonyl)-1,2-oxazole-4-carbohydrazide.
| Compound Name | 3-(2-chloro-6-fluorophenyl)-5-methyl-N'-(3-methyl-1-benzofuran-2-carbonyl)-1,2-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 26377118 |
| Molecular Formula | C21H15ClFN3O4 |
| Molecular Weight | 427.82 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | 3-(2-chloro-6-fluorophenyl)-5-methyl-N'-(3-methyl-1-benzofuran-2-carbonyl)-1,2-oxazole-4-carbohydrazide |
| SMILES | Cc1onc(-c2c(F)cccc2Cl)c1C(=O)NNC(=O)c1oc2ccccc2c1C |
| InChI | InChI=1S/C21H15ClFN3O4/c1-10-12-6-3-4-9-15(12)29-19(10)21(28)25-24-20(27)16-11(2)30-26-18(16)17-13(22)7-5-8-14(17)23/h3-9H,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | UBCMEPMLZUNCDA-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 97.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.82 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|