C20H14ClN3O2S2 — CID 2178225
N-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]carbamothioyl]-3-methyl-1-benzofuran-2-carboxamide (PubChem CID 2178225) has the molecular formula C20H14ClN3O2S2 and a molecular weight of 427.94 g/mol. Its IUPAC name is N-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]carbamothioyl]-3-methyl-1-benzofuran-2-carboxamide.
| Compound Name | N-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]carbamothioyl]-3-methyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 2178225 |
| Molecular Formula | C20H14ClN3O2S2 |
| Molecular Weight | 427.94 g/mol |
| Exact Mass | 427.02 |
| IUPAC Name | N-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]carbamothioyl]-3-methyl-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)NC(=S)Nc2nc(-c3ccc(Cl)cc3)cs2)oc2ccccc12 |
| InChI | InChI=1S/C20H14ClN3O2S2/c1-11-14-4-2-3-5-16(14)26-17(11)18(25)23-19(27)24-20-22-15(10-28-20)12-6-8-13(21)9-7-12/h2-10H,1H3,(H2,22,23,24,25,27) |
| InChIKey | GGLXDIDOKGJLPI-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.94 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|