C18H21N3O3 — CID 119055434
N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-methoxy-1-benzofuran-2-carboxamide (PubChem CID 119055434) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-methoxy-1-benzofuran-2-carboxamide.
| Compound Name | N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-methoxy-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 119055434 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-methoxy-1-benzofuran-2-carboxamide |
| SMILES | COc1c(C(=O)NCCCn2nc(C)cc2C)oc2ccccc12 |
| InChI | InChI=1S/C18H21N3O3/c1-12-11-13(2)21(20-12)10-6-9-19-18(22)17-16(23-3)14-7-4-5-8-15(14)24-17/h4-5,7-8,11H,6,9-10H2,1-3H3,(H,19,22) |
| InChIKey | ZZUZQDBEUQRSMQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|