C20H24N4O3 — CID 29219230
methyl 1-[2-[3-(3,5-dimethylpyrazol-1-yl)propylamino]-2-oxoethyl]indole-3-carboxylate (PubChem CID 29219230) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is methyl 1-[2-[3-(3,5-dimethylpyrazol-1-yl)propylamino]-2-oxoethyl]indole-3-carboxylate.
| Compound Name | methyl 1-[2-[3-(3,5-dimethylpyrazol-1-yl)propylamino]-2-oxoethyl]indole-3-carboxylate |
|---|---|
| PubChem CID | 29219230 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | methyl 1-[2-[3-(3,5-dimethylpyrazol-1-yl)propylamino]-2-oxoethyl]indole-3-carboxylate |
| SMILES | COC(=O)c1cn(CC(=O)NCCCn2nc(C)cc2C)c2ccccc12 |
| InChI | InChI=1S/C20H24N4O3/c1-14-11-15(2)24(22-14)10-6-9-21-19(25)13-23-12-17(20(26)27-3)16-7-4-5-8-18(16)23/h4-5,7-8,11-12H,6,9-10,13H2,1-3H3,(H,21,25) |
| InChIKey | XFNUUJFPNJNTAH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 78.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|