C17H23N3O5S — CID 46434107
methyl 1-[2-[3-[methyl(methylsulfonyl)amino]propylamino]-2-oxoethyl]indole-3-carboxylate (PubChem CID 46434107) has the molecular formula C17H23N3O5S and a molecular weight of 381.45 g/mol. Its IUPAC name is methyl 1-[2-[3-[methyl(methylsulfonyl)amino]propylamino]-2-oxoethyl]indole-3-carboxylate.
| Compound Name | methyl 1-[2-[3-[methyl(methylsulfonyl)amino]propylamino]-2-oxoethyl]indole-3-carboxylate |
|---|---|
| PubChem CID | 46434107 |
| Molecular Formula | C17H23N3O5S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | methyl 1-[2-[3-[methyl(methylsulfonyl)amino]propylamino]-2-oxoethyl]indole-3-carboxylate |
| SMILES | COC(=O)c1cn(CC(=O)NCCCN(C)S(C)(=O)=O)c2ccccc12 |
| InChI | InChI=1S/C17H23N3O5S/c1-19(26(3,23)24)10-6-9-18-16(21)12-20-11-14(17(22)25-2)13-7-4-5-8-15(13)20/h4-5,7-8,11H,6,9-10,12H2,1-3H3,(H,18,21) |
| InChIKey | GLYCUPHOTZZVDD-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|