C12H18N2O2 — CID 1275966
N'-(2,2-dimethylpropyl)-2-hydroxybenzohydrazide (PubChem CID 1275966) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is N'-(2,2-dimethylpropyl)-2-hydroxybenzohydrazide.
| Compound Name | N'-(2,2-dimethylpropyl)-2-hydroxybenzohydrazide |
|---|---|
| PubChem CID | 1275966 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | N'-(2,2-dimethylpropyl)-2-hydroxybenzohydrazide |
| SMILES | CC(C)(C)CNNC(=O)c1ccccc1O |
| InChI | InChI=1S/C12H18N2O2/c1-12(2,3)8-13-14-11(16)9-6-4-5-7-10(9)15/h4-7,13,15H,8H2,1-3H3,(H,14,16) |
| InChIKey | FZECMZLYXPBTIM-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|