C12H14N2O2 — CID 4641225
N'-(1-cyclopropylethenyl)-2-hydroxybenzohydrazide (PubChem CID 4641225) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is N'-(1-cyclopropylethenyl)-2-hydroxybenzohydrazide.
| Compound Name | N'-(1-cyclopropylethenyl)-2-hydroxybenzohydrazide |
|---|---|
| PubChem CID | 4641225 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | N'-(1-cyclopropylethenyl)-2-hydroxybenzohydrazide |
| SMILES | C=C(NNC(=O)c1ccccc1O)C1CC1 |
| InChI | InChI=1S/C12H14N2O2/c1-8(9-6-7-9)13-14-12(16)10-4-2-3-5-11(10)15/h2-5,9,13,15H,1,6-7H2,(H,14,16) |
| InChIKey | RIBYPAKFAJYPBP-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|