About 2-hydroxy-N'-(4-hydroxybenzenecarbothioyl)benzohydrazide
2-hydroxy-N'-(4-hydroxybenzenecarbothioyl)benzohydrazide (PubChem CID 135992560) has the molecular formula C14H12N2O3S
and a molecular weight of 288.33 g/mol. Its IUPAC name is 2-hydroxy-N'-(4-hydroxybenzenecarbothioyl)benzohydrazide.
Molecular Properties
| Compound Name | 2-hydroxy-N'-(4-hydroxybenzenecarbothioyl)benzohydrazide |
| PubChem CID | 135992560 |
| Molecular Formula | C14H12N2O3S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 2-hydroxy-N'-(4-hydroxybenzenecarbothioyl)benzohydrazide |
| SMILES | O=C(NNC(=S)c1ccc(O)cc1)c1ccccc1O |
| InChI | InChI=1S/C14H12N2O3S/c17-10-7-5-9(6-8-10)14(20)16-15-13(19)11-3-1-2-4-12(11)18/h1-8,17-18H,(H,15,19)(H,16,20) |
| InChIKey | BITIKWARIZKCEI-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-N'-(4-hydroxybenzenecarbothioyl)benzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-N'-(4-hydroxybenzenecarbothioyl)benzohydrazide?
The IUPAC name of 2-hydroxy-N'-(4-hydroxybenzenecarbothioyl)benzohydrazide (CID 135992560) is 2-hydroxy-N'-(4-hydroxybenzenecarbothioyl)benzohydrazide.
What is the SMILES notation for 2-hydroxy-N'-(4-hydroxybenzenecarbothioyl)benzohydrazide?
The canonical SMILES for 2-hydroxy-N'-(4-hydroxybenzenecarbothioyl)benzohydrazide is O=C(NNC(=S)c1ccc(O)cc1)c1ccccc1O.
What is the InChIKey of 2-hydroxy-N'-(4-hydroxybenzenecarbothioyl)benzohydrazide?
The InChIKey is BITIKWARIZKCEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O3S/c17-10-7-5-9(6-8-10)14(20)16-15-13(19)11-3-1-2-4-12(11)18/h1-8,17-18H,(H,15,19)(H,16,20).
What are the key properties of 2-hydroxy-N'-(4-hydroxybenzenecarbothioyl)benzohydrazide?
2-hydroxy-N'-(4-hydroxybenzenecarbothioyl)benzohydrazide has a molecular weight of 288.33 g/mol, XLogP of 1.71, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-N'-(4-hydroxybenzenecarbothioyl)benzohydrazide is sourced from PubChem (CID 135992560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).