C24H31NO5S — CID 19244218
4-butoxy-N-(1,1-dioxothiolan-3-yl)-N-[[5-(2-methylcyclopropyl)furan-2-yl]methyl]benzamide (PubChem CID 19244218) has the molecular formula C24H31NO5S and a molecular weight of 445.58 g/mol. Its IUPAC name is 4-butoxy-N-(1,1-dioxothiolan-3-yl)-N-[[5-(2-methylcyclopropyl)furan-2-yl]methyl]benzamide.
| Compound Name | 4-butoxy-N-(1,1-dioxothiolan-3-yl)-N-[[5-(2-methylcyclopropyl)furan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 19244218 |
| Molecular Formula | C24H31NO5S |
| Molecular Weight | 445.58 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | 4-butoxy-N-(1,1-dioxothiolan-3-yl)-N-[[5-(2-methylcyclopropyl)furan-2-yl]methyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)N(Cc2ccc(C3CC3C)o2)C2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C24H31NO5S/c1-3-4-12-29-20-7-5-18(6-8-20)24(26)25(19-11-13-31(27,28)16-19)15-21-9-10-23(30-21)22-14-17(22)2/h5-10,17,19,22H,3-4,11-16H2,1-2H3 |
| InChIKey | ZVJGHGYLPPMDSI-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.58 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|