C26H28FNO5S — CID 40944705
4-butoxy-N-[(3S)-1,1-dioxothiolan-3-yl]-N-[[5-(4-fluorophenyl)furan-2-yl]methyl]benzamide (PubChem CID 40944705) has the molecular formula C26H28FNO5S and a molecular weight of 485.58 g/mol. Its IUPAC name is 4-butoxy-N-[(3S)-1,1-dioxothiolan-3-yl]-N-[[5-(4-fluorophenyl)furan-2-yl]methyl]benzamide.
| Compound Name | 4-butoxy-N-[(3S)-1,1-dioxothiolan-3-yl]-N-[[5-(4-fluorophenyl)furan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 40944705 |
| Molecular Formula | C26H28FNO5S |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | 4-butoxy-N-[(3S)-1,1-dioxothiolan-3-yl]-N-[[5-(4-fluorophenyl)furan-2-yl]methyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)N(Cc2ccc(-c3ccc(F)cc3)o2)[C@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C26H28FNO5S/c1-2-3-15-32-23-10-6-20(7-11-23)26(29)28(22-14-16-34(30,31)18-22)17-24-12-13-25(33-24)19-4-8-21(27)9-5-19/h4-13,22H,2-3,14-18H2,1H3/t22-/m0/s1 |
| InChIKey | RBFRMMBEFZLAKJ-QFIPXVFZSA-N |
| XLogP | 5.09 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|