C24H34N2O4 — CID 24534031
2-(2-acetamido-5-acetylphenoxy)-N,N-dicyclohexylacetamide (PubChem CID 24534031) has the molecular formula C24H34N2O4 and a molecular weight of 414.55 g/mol. Its IUPAC name is 2-(2-acetamido-5-acetylphenoxy)-N,N-dicyclohexylacetamide.
| Compound Name | 2-(2-acetamido-5-acetylphenoxy)-N,N-dicyclohexylacetamide |
|---|---|
| PubChem CID | 24534031 |
| Molecular Formula | C24H34N2O4 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | 2-(2-acetamido-5-acetylphenoxy)-N,N-dicyclohexylacetamide |
| SMILES | CC(=O)Nc1ccc(C(C)=O)cc1OCC(=O)N(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C24H34N2O4/c1-17(27)19-13-14-22(25-18(2)28)23(15-19)30-16-24(29)26(20-9-5-3-6-10-20)21-11-7-4-8-12-21/h13-15,20-21H,3-12,16H2,1-2H3,(H,25,28) |
| InChIKey | QXZISEMTCVCPHM-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |