C15H16Cl3NO4S — CID 7701312
N-cyclopropyl-N-[(3R)-1,1-dioxothiolan-3-yl]-2-(2,4,5-trichlorophenoxy)acetamide (PubChem CID 7701312) has the molecular formula C15H16Cl3NO4S and a molecular weight of 412.72 g/mol. Its IUPAC name is N-cyclopropyl-N-[(3R)-1,1-dioxothiolan-3-yl]-2-(2,4,5-trichlorophenoxy)acetamide.
| Compound Name | N-cyclopropyl-N-[(3R)-1,1-dioxothiolan-3-yl]-2-(2,4,5-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 7701312 |
| Molecular Formula | C15H16Cl3NO4S |
| Molecular Weight | 412.72 g/mol |
| Exact Mass | 410.99 |
| IUPAC Name | N-cyclopropyl-N-[(3R)-1,1-dioxothiolan-3-yl]-2-(2,4,5-trichlorophenoxy)acetamide |
| SMILES | O=C(COc1cc(Cl)c(Cl)cc1Cl)N(C1CC1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H16Cl3NO4S/c16-11-5-13(18)14(6-12(11)17)23-7-15(20)19(9-1-2-9)10-3-4-24(21,22)8-10/h5-6,9-10H,1-4,7-8H2/t10-/m1/s1 |
| InChIKey | ZVNLSRFGWOIBDX-SNVBAGLBSA-N |
| XLogP | 3.20 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.72 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|