C16H16ClNO4 — CID 4908372
2-(6-chloro-7-methoxy-4-methyl-2-oxochromen-3-yl)-N-cyclopropylacetamide (PubChem CID 4908372) has the molecular formula C16H16ClNO4 and a molecular weight of 321.76 g/mol. Its IUPAC name is 2-(6-chloro-7-methoxy-4-methyl-2-oxochromen-3-yl)-N-cyclopropylacetamide.
| Compound Name | 2-(6-chloro-7-methoxy-4-methyl-2-oxochromen-3-yl)-N-cyclopropylacetamide |
|---|---|
| PubChem CID | 4908372 |
| Molecular Formula | C16H16ClNO4 |
| Molecular Weight | 321.76 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 2-(6-chloro-7-methoxy-4-methyl-2-oxochromen-3-yl)-N-cyclopropylacetamide |
| SMILES | COc1cc2oc(=O)c(CC(=O)NC3CC3)c(C)c2cc1Cl |
| InChI | InChI=1S/C16H16ClNO4/c1-8-10-5-12(17)14(21-2)7-13(10)22-16(20)11(8)6-15(19)18-9-3-4-9/h5,7,9H,3-4,6H2,1-2H3,(H,18,19) |
| InChIKey | SGEIEXWGBWZCFT-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.76 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|