C18H15N3O8S — CID 86668471
methyl 2-[4-methyl-7-[(5-nitro-2-pyridinyl)sulfonylamino]-2-oxochromen-3-yl]acetate (PubChem CID 86668471) has the molecular formula C18H15N3O8S and a molecular weight of 433.40 g/mol. Its IUPAC name is methyl 2-[4-methyl-7-[(5-nitro-2-pyridinyl)sulfonylamino]-2-oxochromen-3-yl]acetate.
| Compound Name | methyl 2-[4-methyl-7-[(5-nitro-2-pyridinyl)sulfonylamino]-2-oxochromen-3-yl]acetate |
|---|---|
| PubChem CID | 86668471 |
| Molecular Formula | C18H15N3O8S |
| Molecular Weight | 433.40 g/mol |
| Exact Mass | 433.06 |
| IUPAC Name | methyl 2-[4-methyl-7-[(5-nitro-2-pyridinyl)sulfonylamino]-2-oxochromen-3-yl]acetate |
| SMILES | COC(=O)Cc1c(C)c2ccc(NS(=O)(=O)c3ccc([N+](=O)[O-])cn3)cc2oc1=O |
| InChI | InChI=1S/C18H15N3O8S/c1-10-13-5-3-11(7-15(13)29-18(23)14(10)8-17(22)28-2)20-30(26,27)16-6-4-12(9-19-16)21(24)25/h3-7,9,20H,8H2,1-2H3 |
| InChIKey | FULXRWFNMRVPGO-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 158.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.40 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|