C21H23ClN2O5 — CID 52995310
methyl 2-[7-hydroxy-4,8-dimethyl-2-oxo-6-[(pyridin-4-ylmethylamino)methyl]chromen-3-yl]acetate;hydrochloride (PubChem CID 52995310) has the molecular formula C21H23ClN2O5 and a molecular weight of 418.88 g/mol. Its IUPAC name is methyl 2-[7-hydroxy-4,8-dimethyl-2-oxo-6-[(pyridin-4-ylmethylamino)methyl]chromen-3-yl]acetate;hydrochloride.
| Compound Name | methyl 2-[7-hydroxy-4,8-dimethyl-2-oxo-6-[(pyridin-4-ylmethylamino)methyl]chromen-3-yl]acetate;hydrochloride |
|---|---|
| PubChem CID | 52995310 |
| Molecular Formula | C21H23ClN2O5 |
| Molecular Weight | 418.88 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | methyl 2-[7-hydroxy-4,8-dimethyl-2-oxo-6-[(pyridin-4-ylmethylamino)methyl]chromen-3-yl]acetate;hydrochloride |
| SMILES | COC(=O)Cc1c(C)c2cc(CNCc3ccncc3)c(O)c(C)c2oc1=O.Cl |
| InChI | InChI=1S/C21H22N2O5.ClH/c1-12-16-8-15(11-23-10-14-4-6-22-7-5-14)19(25)13(2)20(16)28-21(26)17(12)9-18(24)27-3;/h4-8,23,25H,9-11H2,1-3H3;1H |
| InChIKey | SNNYJRJCLPYRRQ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.88 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|