C24H24O7 — CID 2955561
ethyl 2-[3-(2-methoxy-2-oxoethyl)-4,8-dimethyl-2-oxochromen-7-yl]oxy-2-phenylacetate (PubChem CID 2955561) has the molecular formula C24H24O7 and a molecular weight of 424.45 g/mol. Its IUPAC name is ethyl 2-[3-(2-methoxy-2-oxoethyl)-4,8-dimethyl-2-oxochromen-7-yl]oxy-2-phenylacetate.
| Compound Name | ethyl 2-[3-(2-methoxy-2-oxoethyl)-4,8-dimethyl-2-oxochromen-7-yl]oxy-2-phenylacetate |
|---|---|
| PubChem CID | 2955561 |
| Molecular Formula | C24H24O7 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | ethyl 2-[3-(2-methoxy-2-oxoethyl)-4,8-dimethyl-2-oxochromen-7-yl]oxy-2-phenylacetate |
| SMILES | CCOC(=O)C(Oc1ccc2c(C)c(CC(=O)OC)c(=O)oc2c1C)c1ccccc1 |
| InChI | InChI=1S/C24H24O7/c1-5-29-24(27)22(16-9-7-6-8-10-16)30-19-12-11-17-14(2)18(13-20(25)28-4)23(26)31-21(17)15(19)3/h6-12,22H,5,13H2,1-4H3 |
| InChIKey | RPPXQTGHESHQQJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 92.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|