C21H20Cl2FNO3 — CID 44667531
8-[[(2-chloro-6-fluorophenyl)methylamino]methyl]-7-hydroxy-6-methyl-2,3-dihydro-1H-cyclopenta[c]chromen-4-one;hydrochloride (PubChem CID 44667531) has the molecular formula C21H20Cl2FNO3 and a molecular weight of 424.30 g/mol. Its IUPAC name is 8-[[(2-chloro-6-fluorophenyl)methylamino]methyl]-7-hydroxy-6-methyl-2,3-dihydro-1H-cyclopenta[c]chromen-4-one;hydrochloride.
| Compound Name | 8-[[(2-chloro-6-fluorophenyl)methylamino]methyl]-7-hydroxy-6-methyl-2,3-dihydro-1H-cyclopenta[c]chromen-4-one;hydrochloride |
|---|---|
| PubChem CID | 44667531 |
| Molecular Formula | C21H20Cl2FNO3 |
| Molecular Weight | 424.30 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | 8-[[(2-chloro-6-fluorophenyl)methylamino]methyl]-7-hydroxy-6-methyl-2,3-dihydro-1H-cyclopenta[c]chromen-4-one;hydrochloride |
| SMILES | Cc1c(O)c(CNCc2c(F)cccc2Cl)cc2c3c(c(=O)oc12)CCC3.Cl |
| InChI | InChI=1S/C21H19ClFNO3.ClH/c1-11-19(25)12(9-24-10-16-17(22)6-3-7-18(16)23)8-15-13-4-2-5-14(13)21(26)27-20(11)15;/h3,6-8,24-25H,2,4-5,9-10H2,1H3;1H |
| InChIKey | QLLZMWUSASYLMR-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.30 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|