C21H18F2O3 — CID 1307087
3-[(2,4-difluorophenyl)methoxy]-4-methyl-7,8,9,10-tetrahydrobenzo[c]chromen-6-one (PubChem CID 1307087) has the molecular formula C21H18F2O3 and a molecular weight of 356.37 g/mol. Its IUPAC name is 3-[(2,4-difluorophenyl)methoxy]-4-methyl-7,8,9,10-tetrahydrobenzo[c]chromen-6-one.
| Compound Name | 3-[(2,4-difluorophenyl)methoxy]-4-methyl-7,8,9,10-tetrahydrobenzo[c]chromen-6-one |
|---|---|
| PubChem CID | 1307087 |
| Molecular Formula | C21H18F2O3 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 3-[(2,4-difluorophenyl)methoxy]-4-methyl-7,8,9,10-tetrahydrobenzo[c]chromen-6-one |
| SMILES | Cc1c(OCc2ccc(F)cc2F)ccc2c3c(c(=O)oc12)CCCC3 |
| InChI | InChI=1S/C21H18F2O3/c1-12-19(25-11-13-6-7-14(22)10-18(13)23)9-8-16-15-4-2-3-5-17(15)21(24)26-20(12)16/h6-10H,2-5,11H2,1H3 |
| InChIKey | DTSKGFIRCHKYTC-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|