C19H16ClFO3 — CID 2244077
7-[(2-chloro-4-fluorophenyl)methoxy]-3,4,8-trimethylchromen-2-one (PubChem CID 2244077) has the molecular formula C19H16ClFO3 and a molecular weight of 346.79 g/mol. Its IUPAC name is 7-[(2-chloro-4-fluorophenyl)methoxy]-3,4,8-trimethylchromen-2-one.
| Compound Name | 7-[(2-chloro-4-fluorophenyl)methoxy]-3,4,8-trimethylchromen-2-one |
|---|---|
| PubChem CID | 2244077 |
| Molecular Formula | C19H16ClFO3 |
| Molecular Weight | 346.79 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 7-[(2-chloro-4-fluorophenyl)methoxy]-3,4,8-trimethylchromen-2-one |
| SMILES | Cc1c(C)c2ccc(OCc3ccc(F)cc3Cl)c(C)c2oc1=O |
| InChI | InChI=1S/C19H16ClFO3/c1-10-11(2)19(22)24-18-12(3)17(7-6-15(10)18)23-9-13-4-5-14(21)8-16(13)20/h4-8H,9H2,1-3H3 |
| InChIKey | GNZFAQIGPFQJBX-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.79 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|