C15H14ClFO — CID 60627601
1-[(2-chloro-4-fluorophenyl)methoxy]-2,4-dimethylbenzene (PubChem CID 60627601) has the molecular formula C15H14ClFO and a molecular weight of 264.73 g/mol. Its IUPAC name is 1-[(2-chloro-4-fluorophenyl)methoxy]-2,4-dimethylbenzene.
| Compound Name | 1-[(2-chloro-4-fluorophenyl)methoxy]-2,4-dimethylbenzene |
|---|---|
| PubChem CID | 60627601 |
| Molecular Formula | C15H14ClFO |
| Molecular Weight | 264.73 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 1-[(2-chloro-4-fluorophenyl)methoxy]-2,4-dimethylbenzene |
| SMILES | Cc1ccc(OCc2ccc(F)cc2Cl)c(C)c1 |
| InChI | InChI=1S/C15H14ClFO/c1-10-3-6-15(11(2)7-10)18-9-12-4-5-13(17)8-14(12)16/h3-8H,9H2,1-2H3 |
| InChIKey | XNLPNXJJPVEIOH-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.73 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |