C21H19ClO3 — CID 5224612
3-[(4-chlorophenyl)methoxy]-4-methyl-7,8,9,10-tetrahydrobenzo[c]chromen-6-one (PubChem CID 5224612) has the molecular formula C21H19ClO3 and a molecular weight of 354.83 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methoxy]-4-methyl-7,8,9,10-tetrahydrobenzo[c]chromen-6-one.
| Compound Name | 3-[(4-chlorophenyl)methoxy]-4-methyl-7,8,9,10-tetrahydrobenzo[c]chromen-6-one |
|---|---|
| PubChem CID | 5224612 |
| Molecular Formula | C21H19ClO3 |
| Molecular Weight | 354.83 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 3-[(4-chlorophenyl)methoxy]-4-methyl-7,8,9,10-tetrahydrobenzo[c]chromen-6-one |
| SMILES | Cc1c(OCc2ccc(Cl)cc2)ccc2c3c(c(=O)oc12)CCCC3 |
| InChI | InChI=1S/C21H19ClO3/c1-13-19(24-12-14-6-8-15(22)9-7-14)11-10-17-16-4-2-3-5-18(16)21(23)25-20(13)17/h6-11H,2-5,12H2,1H3 |
| InChIKey | XZCLHTGMVZQBJA-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.83 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|