C27H20ClN3O4S — CID 163360014
2-[3-(4-chlorophenyl)-5-methyl-7-oxofuro[3,2-g]chromen-6-yl]-N-(pyridin-3-ylmethylcarbamothioyl)acetamide (PubChem CID 163360014) has the molecular formula C27H20ClN3O4S and a molecular weight of 517.99 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)-5-methyl-7-oxofuro[3,2-g]chromen-6-yl]-N-(pyridin-3-ylmethylcarbamothioyl)acetamide.
| Compound Name | 2-[3-(4-chlorophenyl)-5-methyl-7-oxofuro[3,2-g]chromen-6-yl]-N-(pyridin-3-ylmethylcarbamothioyl)acetamide |
|---|---|
| PubChem CID | 163360014 |
| Molecular Formula | C27H20ClN3O4S |
| Molecular Weight | 517.99 g/mol |
| Exact Mass | 517.09 |
| IUPAC Name | 2-[3-(4-chlorophenyl)-5-methyl-7-oxofuro[3,2-g]chromen-6-yl]-N-(pyridin-3-ylmethylcarbamothioyl)acetamide |
| SMILES | Cc1c(CC(=O)NC(=S)NCc2cccnc2)c(=O)oc2cc3occ(-c4ccc(Cl)cc4)c3cc12 |
| InChI | InChI=1S/C27H20ClN3O4S/c1-15-19-9-21-22(17-4-6-18(28)7-5-17)14-34-23(21)11-24(19)35-26(33)20(15)10-25(32)31-27(36)30-13-16-3-2-8-29-12-16/h2-9,11-12,14H,10,13H2,1H3,(H2,30,31,32,36) |
| InChIKey | FRKNZAMNVMALMA-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 97.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.99 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|