C31H41N3O6 — CID 166082845
4-[3-[[2-(7-amino-4-methyl-2-oxochromen-3-yl)acetyl]amino]-3-methylbutoxy]-N-[2-(4-hydroxyphenyl)ethyl]-4-methylpentanamide (PubChem CID 166082845) has the molecular formula C31H41N3O6 and a molecular weight of 551.68 g/mol. Its IUPAC name is 4-[3-[[2-(7-amino-4-methyl-2-oxochromen-3-yl)acetyl]amino]-3-methylbutoxy]-N-[2-(4-hydroxyphenyl)ethyl]-4-methylpentanamide.
| Compound Name | 4-[3-[[2-(7-amino-4-methyl-2-oxochromen-3-yl)acetyl]amino]-3-methylbutoxy]-N-[2-(4-hydroxyphenyl)ethyl]-4-methylpentanamide |
|---|---|
| PubChem CID | 166082845 |
| Molecular Formula | C31H41N3O6 |
| Molecular Weight | 551.68 g/mol |
| Exact Mass | 551.30 |
| IUPAC Name | 4-[3-[[2-(7-amino-4-methyl-2-oxochromen-3-yl)acetyl]amino]-3-methylbutoxy]-N-[2-(4-hydroxyphenyl)ethyl]-4-methylpentanamide |
| SMILES | Cc1c(CC(=O)NC(C)(C)CCOC(C)(C)CCC(=O)NCCc2ccc(O)cc2)c(=O)oc2cc(N)ccc12 |
| InChI | InChI=1S/C31H41N3O6/c1-20-24-11-8-22(32)18-26(24)40-29(38)25(20)19-28(37)34-30(2,3)15-17-39-31(4,5)14-12-27(36)33-16-13-21-6-9-23(35)10-7-21/h6-11,18,35H,12-17,19,32H2,1-5H3,(H,33,36)(H,34,37) |
| InChIKey | RXHAUTKDJAXMFA-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 143.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.68 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|