C35H51N4O6+ — CID 143702494
[9-[5-(dimethylamino)-4-[ethyl-(4-methoxy-4-oxobutyl)amino]-2-methoxyphenyl]-6-methylperoxyxanthen-3-ylidene]-dimethylazanium;ethane;methanamine (PubChem CID 143702494) has the molecular formula C35H51N4O6+ and a molecular weight of 623.82 g/mol. Its IUPAC name is [9-[5-(dimethylamino)-4-[ethyl-(4-methoxy-4-oxobutyl)amino]-2-methoxyphenyl]-6-methylperoxyxanthen-3-ylidene]-dimethylazanium;ethane;methanamine.
| Compound Name | [9-[5-(dimethylamino)-4-[ethyl-(4-methoxy-4-oxobutyl)amino]-2-methoxyphenyl]-6-methylperoxyxanthen-3-ylidene]-dimethylazanium;ethane;methanamine |
|---|---|
| PubChem CID | 143702494 |
| Molecular Formula | C35H51N4O6+ |
| Molecular Weight | 623.82 g/mol |
| Exact Mass | 623.38 |
| IUPAC Name | [9-[5-(dimethylamino)-4-[ethyl-(4-methoxy-4-oxobutyl)amino]-2-methoxyphenyl]-6-methylperoxyxanthen-3-ylidene]-dimethylazanium;ethane;methanamine |
| SMILES | CC.CCN(CCCC(=O)OC)c1cc(OC)c(-c2c3ccc(=[N+](C)C)cc-3oc3cc(OOC)ccc23)cc1N(C)C.CN |
| InChI | InChI=1S/C32H40N3O6.C2H6.CH5N/c1-9-35(16-10-11-31(36)38-7)27-20-28(37-6)25(19-26(27)34(4)5)32-23-14-12-21(33(2)3)17-29(23)40-30-18-22(41-39-8)13-15-24(30)32;2*1-2/h12-15,17-20H,9-11,16H2,1-8H3;1-2H3;2H2,1H3/q+1;; |
| InChIKey | PBDHUJCKSWCONU-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 102.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.82 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|