C38H49N3O8 — CID 59839488
ethyl 4-[4-[6-[bis(3-methoxy-3-oxopropyl)amino]-3H-xanthen-9-yl]-2-(dimethylamino)-N-ethyl-5-methoxyanilino]butanoate (PubChem CID 59839488) has the molecular formula C38H49N3O8 and a molecular weight of 675.82 g/mol. Its IUPAC name is ethyl 4-[4-[6-[bis(3-methoxy-3-oxopropyl)amino]-3H-xanthen-9-yl]-2-(dimethylamino)-N-ethyl-5-methoxyanilino]butanoate.
| Compound Name | ethyl 4-[4-[6-[bis(3-methoxy-3-oxopropyl)amino]-3H-xanthen-9-yl]-2-(dimethylamino)-N-ethyl-5-methoxyanilino]butanoate |
|---|---|
| PubChem CID | 59839488 |
| Molecular Formula | C38H49N3O8 |
| Molecular Weight | 675.82 g/mol |
| Exact Mass | 675.35 |
| IUPAC Name | ethyl 4-[4-[6-[bis(3-methoxy-3-oxopropyl)amino]-3H-xanthen-9-yl]-2-(dimethylamino)-N-ethyl-5-methoxyanilino]butanoate |
| SMILES | CCOC(=O)CCCN(CC)c1cc(OC)c(C2=C3C=CCC=C3Oc3cc(N(CCC(=O)OC)CCC(=O)OC)ccc32)cc1N(C)C |
| InChI | InChI=1S/C38H49N3O8/c1-8-40(20-12-15-37(44)48-9-2)31-25-33(45-5)29(24-30(31)39(3)4)38-27-13-10-11-14-32(27)49-34-23-26(16-17-28(34)38)41(21-18-35(42)46-6)22-19-36(43)47-7/h10,13-14,16-17,23-25H,8-9,11-12,15,18-22H2,1-7H3 |
| InChIKey | ORIOEOMAJQQQSC-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 107.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.82 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|