C43H56N4O3 — CID 143702497
ethyl 4-[2-(dimethylamino)-N,5-diethyl-4-(3-oxa-9,23-diazaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1(27),2(17),4(15),5(28),13,18-hexaen-16-yl)anilino]butanoate (PubChem CID 143702497) has the molecular formula C43H56N4O3 and a molecular weight of 676.95 g/mol. Its IUPAC name is ethyl 4-[2-(dimethylamino)-N,5-diethyl-4-(3-oxa-9,23-diazaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1(27),2(17),4(15),5(28),13,18-hexaen-16-yl)anilino]butanoate.
| Compound Name | ethyl 4-[2-(dimethylamino)-N,5-diethyl-4-(3-oxa-9,23-diazaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1(27),2(17),4(15),5(28),13,18-hexaen-16-yl)anilino]butanoate |
|---|---|
| PubChem CID | 143702497 |
| Molecular Formula | C43H56N4O3 |
| Molecular Weight | 676.95 g/mol |
| Exact Mass | 676.44 |
| IUPAC Name | ethyl 4-[2-(dimethylamino)-N,5-diethyl-4-(3-oxa-9,23-diazaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1(27),2(17),4(15),5(28),13,18-hexaen-16-yl)anilino]butanoate |
| SMILES | CCOC(=O)CCCN(CC)c1cc(CC)c(C2c3cc4c5c(c3Oc3c2cc2c6c3CCCN6CCC2)CCCN5CCC4)cc1N(C)C |
| InChI | InChI=1S/C43H56N4O3/c1-6-28-26-37(45(7-2)19-13-18-38(48)49-8-3)36(44(4)5)27-33(28)39-34-24-29-14-9-20-46-22-11-16-31(40(29)46)42(34)50-43-32-17-12-23-47-21-10-15-30(41(32)47)25-35(39)43/h24-27,39H,6-23H2,1-5H3 |
| InChIKey | WXVBXQWVEDODJJ-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 48.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.95 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|