C17H25NO5 — CID 59839437
ethyl 4-(N-ethyl-4-formyl-2,5-dimethoxyanilino)butanoate (PubChem CID 59839437) has the molecular formula C17H25NO5 and a molecular weight of 323.39 g/mol. Its IUPAC name is ethyl 4-(N-ethyl-4-formyl-2,5-dimethoxyanilino)butanoate.
| Compound Name | ethyl 4-(N-ethyl-4-formyl-2,5-dimethoxyanilino)butanoate |
|---|---|
| PubChem CID | 59839437 |
| Molecular Formula | C17H25NO5 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | ethyl 4-(N-ethyl-4-formyl-2,5-dimethoxyanilino)butanoate |
| SMILES | CCOC(=O)CCCN(CC)c1cc(OC)c(C=O)cc1OC |
| InChI | InChI=1S/C17H25NO5/c1-5-18(9-7-8-17(20)23-6-2)14-11-15(21-3)13(12-19)10-16(14)22-4/h10-12H,5-9H2,1-4H3 |
| InChIKey | AJWSAGXUGJCEGG-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|