C18H24INO3S — CID 163273184
ethyl 4-[2-(diethylamino)-4-(2-iodosulfanylethynyl)phenoxy]butanoate (PubChem CID 163273184) has the molecular formula C18H24INO3S and a molecular weight of 461.37 g/mol. Its IUPAC name is ethyl 4-[2-(diethylamino)-4-(2-iodosulfanylethynyl)phenoxy]butanoate.
| Compound Name | ethyl 4-[2-(diethylamino)-4-(2-iodosulfanylethynyl)phenoxy]butanoate |
|---|---|
| PubChem CID | 163273184 |
| Molecular Formula | C18H24INO3S |
| Molecular Weight | 461.37 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | ethyl 4-[2-(diethylamino)-4-(2-iodosulfanylethynyl)phenoxy]butanoate |
| SMILES | CCOC(=O)CCCOc1ccc(C#CSI)cc1N(CC)CC |
| InChI | InChI=1S/C18H24INO3S/c1-4-20(5-2)16-14-15(11-13-24-19)9-10-17(16)23-12-7-8-18(21)22-6-3/h9-10,14H,4-8,12H2,1-3H3 |
| InChIKey | FGODKKHRVCZWBN-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.37 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|