C17H23NO3S — CID 167045007
4-[2-(diethylamino)-4-(2-methylsulfanylethynyl)phenoxy]butanoic acid (PubChem CID 167045007) has the molecular formula C17H23NO3S and a molecular weight of 321.44 g/mol. Its IUPAC name is 4-[2-(diethylamino)-4-(2-methylsulfanylethynyl)phenoxy]butanoic acid.
| Compound Name | 4-[2-(diethylamino)-4-(2-methylsulfanylethynyl)phenoxy]butanoic acid |
|---|---|
| PubChem CID | 167045007 |
| Molecular Formula | C17H23NO3S |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 4-[2-(diethylamino)-4-(2-methylsulfanylethynyl)phenoxy]butanoic acid |
| SMILES | CCN(CC)c1cc(C#CSC)ccc1OCCCC(=O)O |
| InChI | InChI=1S/C17H23NO3S/c1-4-18(5-2)15-13-14(10-12-22-3)8-9-16(15)21-11-6-7-17(19)20/h8-9,13H,4-7,11H2,1-3H3,(H,19,20) |
| InChIKey | JODZZTCXWYILCR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|