C30H35N5O9-4 — CID 170528619
2-[[4-[2-[4-(3-aminopropoxy)-3-(diethylamino)phenyl]ethynyl]-6-[[bis(carboxylatomethyl)amino]methyl]-2-pyridinyl]methyl-(carboxylatomethyl)amino]acetate (PubChem CID 170528619) has the molecular formula C30H35N5O9-4 and a molecular weight of 609.64 g/mol. Its IUPAC name is 2-[[4-[2-[4-(3-aminopropoxy)-3-(diethylamino)phenyl]ethynyl]-6-[[bis(carboxylatomethyl)amino]methyl]-2-pyridinyl]methyl-(carboxylatomethyl)amino]acetate.
| Compound Name | 2-[[4-[2-[4-(3-aminopropoxy)-3-(diethylamino)phenyl]ethynyl]-6-[[bis(carboxylatomethyl)amino]methyl]-2-pyridinyl]methyl-(carboxylatomethyl)amino]acetate |
|---|---|
| PubChem CID | 170528619 |
| Molecular Formula | C30H35N5O9-4 |
| Molecular Weight | 609.64 g/mol |
| Exact Mass | 609.25 |
| IUPAC Name | 2-[[4-[2-[4-(3-aminopropoxy)-3-(diethylamino)phenyl]ethynyl]-6-[[bis(carboxylatomethyl)amino]methyl]-2-pyridinyl]methyl-(carboxylatomethyl)amino]acetate |
| SMILES | CCN(CC)c1cc(C#Cc2cc(CN(CC(=O)[O-])CC(=O)[O-])nc(CN(CC(=O)[O-])CC(=O)[O-])c2)ccc1OCCCN |
| InChI | InChI=1S/C30H39N5O9/c1-3-35(4-2)25-14-21(8-9-26(25)44-11-5-10-31)6-7-22-12-23(15-33(17-27(36)37)18-28(38)39)32-24(13-22)16-34(19-29(40)41)20-30(42)43/h8-9,12-14H,3-5,10-11,15-20,31H2,1-2H3,(H,36,37)(H,38,39)(H,40,41)(H,42,43)/p-4 |
| InChIKey | WLOHEVMZAOFBOX-UHFFFAOYSA-J |
| XLogP | -4.34 |
| TPSA | 218.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.64 |
| LogP ≤ 5 | -4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|