C31H39N3O11 — CID 23393270
methyl 2-[[6-[[bis(2-methoxy-2-oxoethyl)amino]methyl]-4-[2-[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]ethynyl]-2-pyridinyl]methyl-(2-methoxy-2-oxoethyl)amino]acetate (PubChem CID 23393270) has the molecular formula C31H39N3O11 and a molecular weight of 629.66 g/mol. Its IUPAC name is methyl 2-[[6-[[bis(2-methoxy-2-oxoethyl)amino]methyl]-4-[2-[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]ethynyl]-2-pyridinyl]methyl-(2-methoxy-2-oxoethyl)amino]acetate.
| Compound Name | methyl 2-[[6-[[bis(2-methoxy-2-oxoethyl)amino]methyl]-4-[2-[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]ethynyl]-2-pyridinyl]methyl-(2-methoxy-2-oxoethyl)amino]acetate |
|---|---|
| PubChem CID | 23393270 |
| Molecular Formula | C31H39N3O11 |
| Molecular Weight | 629.66 g/mol |
| Exact Mass | 629.26 |
| IUPAC Name | methyl 2-[[6-[[bis(2-methoxy-2-oxoethyl)amino]methyl]-4-[2-[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]ethynyl]-2-pyridinyl]methyl-(2-methoxy-2-oxoethyl)amino]acetate |
| SMILES | COC(=O)CN(CC(=O)OC)Cc1cc(C#Cc2ccc(OCCOCCO)cc2)cc(CN(CC(=O)OC)CC(=O)OC)n1 |
| InChI | InChI=1S/C31H39N3O11/c1-40-28(36)19-33(20-29(37)41-2)17-25-15-24(6-5-23-7-9-27(10-8-23)45-14-13-44-12-11-35)16-26(32-25)18-34(21-30(38)42-3)22-31(39)43-4/h7-10,15-16,35H,11-14,17-22H2,1-4H3 |
| InChIKey | GSIPKQZFBBSXAK-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 163.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.66 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|