C13H17Cl2NO3 — CID 131855113
4-[bis(2-chloroethyl)amino]-2,5-dimethoxybenzaldehyde (PubChem CID 131855113) has the molecular formula C13H17Cl2NO3 and a molecular weight of 306.19 g/mol. Its IUPAC name is 4-[bis(2-chloroethyl)amino]-2,5-dimethoxybenzaldehyde.
| Compound Name | 4-[bis(2-chloroethyl)amino]-2,5-dimethoxybenzaldehyde |
|---|---|
| PubChem CID | 131855113 |
| Molecular Formula | C13H17Cl2NO3 |
| Molecular Weight | 306.19 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 4-[bis(2-chloroethyl)amino]-2,5-dimethoxybenzaldehyde |
| SMILES | COc1cc(N(CCCl)CCCl)c(OC)cc1C=O |
| InChI | InChI=1S/C13H17Cl2NO3/c1-18-12-8-11(16(5-3-14)6-4-15)13(19-2)7-10(12)9-17/h7-9H,3-6H2,1-2H3 |
| InChIKey | QHTBMEUHPGKXFD-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.19 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|