C16H21NO5 — CID 139237456
methyl 2-[acetyl-(4-ethoxy-4-oxobutyl)amino]benzoate (PubChem CID 139237456) has the molecular formula C16H21NO5 and a molecular weight of 307.35 g/mol. Its IUPAC name is methyl 2-[acetyl-(4-ethoxy-4-oxobutyl)amino]benzoate.
| Compound Name | methyl 2-[acetyl-(4-ethoxy-4-oxobutyl)amino]benzoate |
|---|---|
| PubChem CID | 139237456 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | methyl 2-[acetyl-(4-ethoxy-4-oxobutyl)amino]benzoate |
| SMILES | CCOC(=O)CCCN(C(C)=O)c1ccccc1C(=O)OC |
| InChI | InChI=1S/C16H21NO5/c1-4-22-15(19)10-7-11-17(12(2)18)14-9-6-5-8-13(14)16(20)21-3/h5-6,8-9H,4,7,10-11H2,1-3H3 |
| InChIKey | GZTUAIWDHVQKJR-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |