C18H24N2O4 — CID 113131207
methyl 2-[acetyl-(3-oxo-3-piperidin-1-ylpropyl)amino]benzoate (PubChem CID 113131207) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is methyl 2-[acetyl-(3-oxo-3-piperidin-1-ylpropyl)amino]benzoate.
| Compound Name | methyl 2-[acetyl-(3-oxo-3-piperidin-1-ylpropyl)amino]benzoate |
|---|---|
| PubChem CID | 113131207 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | methyl 2-[acetyl-(3-oxo-3-piperidin-1-ylpropyl)amino]benzoate |
| SMILES | COC(=O)c1ccccc1N(CCC(=O)N1CCCCC1)C(C)=O |
| InChI | InChI=1S/C18H24N2O4/c1-14(21)20(13-10-17(22)19-11-6-3-7-12-19)16-9-5-4-8-15(16)18(23)24-2/h4-5,8-9H,3,6-7,10-13H2,1-2H3 |
| InChIKey | NERSIRWMDQNJQP-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |