C17H22F2N2O2 — CID 113135398
N-[3-(azepan-1-yl)-3-oxopropyl]-N-(2,6-difluorophenyl)acetamide (PubChem CID 113135398) has the molecular formula C17H22F2N2O2 and a molecular weight of 324.37 g/mol. Its IUPAC name is N-[3-(azepan-1-yl)-3-oxopropyl]-N-(2,6-difluorophenyl)acetamide.
| Compound Name | N-[3-(azepan-1-yl)-3-oxopropyl]-N-(2,6-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 113135398 |
| Molecular Formula | C17H22F2N2O2 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | N-[3-(azepan-1-yl)-3-oxopropyl]-N-(2,6-difluorophenyl)acetamide |
| SMILES | CC(=O)N(CCC(=O)N1CCCCCC1)c1c(F)cccc1F |
| InChI | InChI=1S/C17H22F2N2O2/c1-13(22)21(17-14(18)7-6-8-15(17)19)12-9-16(23)20-10-4-2-3-5-11-20/h6-8H,2-5,9-12H2,1H3 |
| InChIKey | RUFKKKWHJHNPJX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |