C16H20F2N2O2 — CID 113133399
N-(2,4-difluorophenyl)-N-(3-oxo-3-piperidin-1-ylpropyl)acetamide (PubChem CID 113133399) has the molecular formula C16H20F2N2O2 and a molecular weight of 310.34 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-N-(3-oxo-3-piperidin-1-ylpropyl)acetamide.
| Compound Name | N-(2,4-difluorophenyl)-N-(3-oxo-3-piperidin-1-ylpropyl)acetamide |
|---|---|
| PubChem CID | 113133399 |
| Molecular Formula | C16H20F2N2O2 |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | N-(2,4-difluorophenyl)-N-(3-oxo-3-piperidin-1-ylpropyl)acetamide |
| SMILES | CC(=O)N(CCC(=O)N1CCCCC1)c1ccc(F)cc1F |
| InChI | InChI=1S/C16H20F2N2O2/c1-12(21)20(15-6-5-13(17)11-14(15)18)10-7-16(22)19-8-3-2-4-9-19/h5-6,11H,2-4,7-10H2,1H3 |
| InChIKey | DHUZWGALNQMLFB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |