C31H36N4O8 — CID 176869487
5-[1-[2-[2-[2-[2-(aminomethylamino)ethoxy]ethoxy]ethoxy]ethylamino]ethenylamino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid (PubChem CID 176869487) has the molecular formula C31H36N4O8 and a molecular weight of 592.65 g/mol. Its IUPAC name is 5-[1-[2-[2-[2-[2-(aminomethylamino)ethoxy]ethoxy]ethoxy]ethylamino]ethenylamino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid.
| Compound Name | 5-[1-[2-[2-[2-[2-(aminomethylamino)ethoxy]ethoxy]ethoxy]ethylamino]ethenylamino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 176869487 |
| Molecular Formula | C31H36N4O8 |
| Molecular Weight | 592.65 g/mol |
| Exact Mass | 592.25 |
| IUPAC Name | 5-[1-[2-[2-[2-[2-(aminomethylamino)ethoxy]ethoxy]ethoxy]ethylamino]ethenylamino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
| SMILES | C=C(NCCOCCOCCOCCNCN)Nc1ccc(-c2c3ccc(=O)cc-3oc3cc(O)ccc23)c(C(=O)O)c1 |
| InChI | InChI=1S/C31H36N4O8/c1-20(34-9-11-41-13-15-42-14-12-40-10-8-33-19-32)35-21-2-5-24(27(16-21)31(38)39)30-25-6-3-22(36)17-28(25)43-29-18-23(37)4-7-26(29)30/h2-7,16-18,33-36H,1,8-15,19,32H2,(H,38,39) |
| InChIKey | NARGXQBWJZKMNI-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 177.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.65 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|