C40H47N3O11 — CID 145172317
(4Z)-bicyclo[6.1.0]non-4-ene;2-(3-hydroxy-6-oxoxanthen-9-yl)-5-[2-[2-[2-[2-(methoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethylcarbamoylamino]benzoic acid (PubChem CID 145172317) has the molecular formula C40H47N3O11 and a molecular weight of 745.83 g/mol. Its IUPAC name is (4Z)-bicyclo[6.1.0]non-4-ene;2-(3-hydroxy-6-oxoxanthen-9-yl)-5-[2-[2-[2-[2-(methoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethylcarbamoylamino]benzoic acid.
| Compound Name | (4Z)-bicyclo[6.1.0]non-4-ene;2-(3-hydroxy-6-oxoxanthen-9-yl)-5-[2-[2-[2-[2-(methoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethylcarbamoylamino]benzoic acid |
|---|---|
| PubChem CID | 145172317 |
| Molecular Formula | C40H47N3O11 |
| Molecular Weight | 745.83 g/mol |
| Exact Mass | 745.32 |
| IUPAC Name | (4Z)-bicyclo[6.1.0]non-4-ene;2-(3-hydroxy-6-oxoxanthen-9-yl)-5-[2-[2-[2-[2-(methoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethylcarbamoylamino]benzoic acid |
| SMILES | C1=C\CCC2CC2CC/1.COC(=O)NCCOCCOCCOCCNC(=O)Nc1ccc(-c2c3ccc(=O)cc-3oc3cc(O)ccc23)c(C(=O)O)c1 |
| InChI | InChI=1S/C31H33N3O11.C9H14/c1-41-31(40)33-9-11-43-13-15-44-14-12-42-10-8-32-30(39)34-19-2-5-22(25(16-19)29(37)38)28-23-6-3-20(35)17-26(23)45-27-18-21(36)4-7-24(27)28;1-2-4-6-9-7-8(9)5-3-1/h2-7,16-18,35H,8-15H2,1H3,(H,33,40)(H,37,38)(H2,32,34,39);1-2,8-9H,3-7H2/b;2-1- |
| InChIKey | WLBKBOZHGNPOBC-BTJKTKAUSA-N |
| XLogP | 6.25 |
| TPSA | 194.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.83 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|