C29H23N3O8S — CID 59404302
5-[2-(4-aminoperoxysulfanylphenyl)ethylcarbamoylamino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid (PubChem CID 59404302) has the molecular formula C29H23N3O8S and a molecular weight of 573.58 g/mol. Its IUPAC name is 5-[2-(4-aminoperoxysulfanylphenyl)ethylcarbamoylamino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid.
| Compound Name | 5-[2-(4-aminoperoxysulfanylphenyl)ethylcarbamoylamino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 59404302 |
| Molecular Formula | C29H23N3O8S |
| Molecular Weight | 573.58 g/mol |
| Exact Mass | 573.12 |
| IUPAC Name | 5-[2-(4-aminoperoxysulfanylphenyl)ethylcarbamoylamino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
| SMILES | NOOSc1ccc(CCNC(=O)Nc2ccc(-c3c4ccc(=O)cc-4oc4cc(O)ccc34)c(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C29H23N3O8S/c30-39-40-41-20-6-1-16(2-7-20)11-12-31-29(37)32-17-3-8-21(24(13-17)28(35)36)27-22-9-4-18(33)14-25(22)38-26-15-19(34)5-10-23(26)27/h1-10,13-15,33H,11-12,30H2,(H,35,36)(H2,31,32,37) |
| InChIKey | IQGFUKNZASJYND-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 173.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.58 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|