C29H29NO6 — CID 144807131
2-methylpropyl 2-[3-[4-(methylamino)-4-oxobutoxy]-6-oxoxanthen-9-yl]benzoate (PubChem CID 144807131) has the molecular formula C29H29NO6 and a molecular weight of 487.55 g/mol. Its IUPAC name is 2-methylpropyl 2-[3-[4-(methylamino)-4-oxobutoxy]-6-oxoxanthen-9-yl]benzoate.
| Compound Name | 2-methylpropyl 2-[3-[4-(methylamino)-4-oxobutoxy]-6-oxoxanthen-9-yl]benzoate |
|---|---|
| PubChem CID | 144807131 |
| Molecular Formula | C29H29NO6 |
| Molecular Weight | 487.55 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | 2-methylpropyl 2-[3-[4-(methylamino)-4-oxobutoxy]-6-oxoxanthen-9-yl]benzoate |
| SMILES | CNC(=O)CCCOc1ccc2c(-c3ccccc3C(=O)OCC(C)C)c3ccc(=O)cc-3oc2c1 |
| InChI | InChI=1S/C29H29NO6/c1-18(2)17-35-29(33)22-8-5-4-7-21(22)28-23-12-10-19(31)15-25(23)36-26-16-20(11-13-24(26)28)34-14-6-9-27(32)30-3/h4-5,7-8,10-13,15-16,18H,6,9,14,17H2,1-3H3,(H,30,32) |
| InChIKey | TYFJRRLXYCDHLI-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.55 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|