C27H27NO4 — CID 156565290
6-(6-aminohexoxy)-9-(2-methylbenzoyl)xanthen-3-one (PubChem CID 156565290) has the molecular formula C27H27NO4 and a molecular weight of 429.52 g/mol. Its IUPAC name is 6-(6-aminohexoxy)-9-(2-methylbenzoyl)xanthen-3-one.
| Compound Name | 6-(6-aminohexoxy)-9-(2-methylbenzoyl)xanthen-3-one |
|---|---|
| PubChem CID | 156565290 |
| Molecular Formula | C27H27NO4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 6-(6-aminohexoxy)-9-(2-methylbenzoyl)xanthen-3-one |
| SMILES | Cc1ccccc1C(=O)c1c2ccc(=O)cc-2oc2cc(OCCCCCCN)ccc12 |
| InChI | InChI=1S/C27H27NO4/c1-18-8-4-5-9-21(18)27(30)26-22-12-10-19(29)16-24(22)32-25-17-20(11-13-23(25)26)31-15-7-3-2-6-14-28/h4-5,8-13,16-17H,2-3,6-7,14-15,28H2,1H3 |
| InChIKey | XZLLFMBFQPLFGA-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|