About 6-[(3,5-dinitrophenyl)methoxy]-9-(2-methylbenzoyl)xanthen-3-one
6-[(3,5-dinitrophenyl)methoxy]-9-(2-methylbenzoyl)xanthen-3-one (PubChem CID 87840853) has the molecular formula C28H18N2O8
and a molecular weight of 510.46 g/mol. Its IUPAC name is 6-[(3,5-dinitrophenyl)methoxy]-9-(2-methylbenzoyl)xanthen-3-one.
Molecular Properties
| Compound Name | 6-[(3,5-dinitrophenyl)methoxy]-9-(2-methylbenzoyl)xanthen-3-one |
| PubChem CID | 87840853 |
| Molecular Formula | C28H18N2O8 |
| Molecular Weight | 510.46 g/mol |
| Exact Mass | 510.11 |
| IUPAC Name | 6-[(3,5-dinitrophenyl)methoxy]-9-(2-methylbenzoyl)xanthen-3-one |
| SMILES | Cc1ccccc1C(=O)c1c2ccc(=O)cc-2oc2cc(OCc3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)ccc12 |
| InChI | InChI=1S/C28H18N2O8/c1-16-4-2-3-5-22(16)28(32)27-23-8-6-20(31)13-25(23)38-26-14-21(7-9-24(26)27)37-15-17-10-18(29(33)34)12-19(11-17)30(35)36/h2-14H,15H2,1H3 |
| InChIKey | PWKJXCHECVWBNN-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 142.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 510.46 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 6-[(3,5-dinitrophenyl)methoxy]-9-(2-methylbenzoyl)xanthen-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(3,5-dinitrophenyl)methoxy]-9-(2-methylbenzoyl)xanthen-3-one?
The IUPAC name of 6-[(3,5-dinitrophenyl)methoxy]-9-(2-methylbenzoyl)xanthen-3-one (CID 87840853) is 6-[(3,5-dinitrophenyl)methoxy]-9-(2-methylbenzoyl)xanthen-3-one.
What is the SMILES notation for 6-[(3,5-dinitrophenyl)methoxy]-9-(2-methylbenzoyl)xanthen-3-one?
The canonical SMILES for 6-[(3,5-dinitrophenyl)methoxy]-9-(2-methylbenzoyl)xanthen-3-one is Cc1ccccc1C(=O)c1c2ccc(=O)cc-2oc2cc(OCc3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)ccc12.
What is the InChIKey of 6-[(3,5-dinitrophenyl)methoxy]-9-(2-methylbenzoyl)xanthen-3-one?
The InChIKey is PWKJXCHECVWBNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H18N2O8/c1-16-4-2-3-5-22(16)28(32)27-23-8-6-20(31)13-25(23)38-26-14-21(7-9-24(26)27)37-15-17-10-18(29(33)34)12-19(11-17)30(35)36/h2-14H,15H2,1H3.
What are the key properties of 6-[(3,5-dinitrophenyl)methoxy]-9-(2-methylbenzoyl)xanthen-3-one?
6-[(3,5-dinitrophenyl)methoxy]-9-(2-methylbenzoyl)xanthen-3-one has a molecular weight of 510.46 g/mol, XLogP of 5.83, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(3,5-dinitrophenyl)methoxy]-9-(2-methylbenzoyl)xanthen-3-one is sourced from PubChem (CID 87840853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).