C38H29N3O9 — CID 145258842
[9-[2-methyl-4-[2-[(3-nitro-5-nitrosobenzoyl)amino]ethoxy]phenyl]-6-oxoxanthen-3-yl] 2-(4-methylphenyl)acetate (PubChem CID 145258842) has the molecular formula C38H29N3O9 and a molecular weight of 671.66 g/mol. Its IUPAC name is [9-[2-methyl-4-[2-[(3-nitro-5-nitrosobenzoyl)amino]ethoxy]phenyl]-6-oxoxanthen-3-yl] 2-(4-methylphenyl)acetate.
| Compound Name | [9-[2-methyl-4-[2-[(3-nitro-5-nitrosobenzoyl)amino]ethoxy]phenyl]-6-oxoxanthen-3-yl] 2-(4-methylphenyl)acetate |
|---|---|
| PubChem CID | 145258842 |
| Molecular Formula | C38H29N3O9 |
| Molecular Weight | 671.66 g/mol |
| Exact Mass | 671.19 |
| IUPAC Name | [9-[2-methyl-4-[2-[(3-nitro-5-nitrosobenzoyl)amino]ethoxy]phenyl]-6-oxoxanthen-3-yl] 2-(4-methylphenyl)acetate |
| SMILES | Cc1ccc(CC(=O)Oc2ccc3c(-c4ccc(OCCNC(=O)c5cc(N=O)cc([N+](=O)[O-])c5)cc4C)c4ccc(=O)cc-4oc3c2)cc1 |
| InChI | InChI=1S/C38H29N3O9/c1-22-3-5-24(6-4-22)16-36(43)49-30-9-12-33-35(21-30)50-34-20-28(42)7-10-32(34)37(33)31-11-8-29(15-23(31)2)48-14-13-39-38(44)25-17-26(40-45)19-27(18-25)41(46)47/h3-12,15,17-21H,13-14,16H2,1-2H3,(H,39,44) |
| InChIKey | VYPGRJCXOCMYTK-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 167.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.66 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|